ethyl 2-nitropropionate


ethyl 2-nitropropionate
CAS RN:[2531-80-8]
Formula:C5H9NO4; 147.13 g/mol
InChiKey:ZXBGJDZWJJFFQY-UHFFFAOYSA-N
SMILES:CCOC(=O)C(C)[N+]([O-])=O
Molecular structure of ethyl 2-nitropropionate
Density:1.130 g/mL
Molar volume:130.2 mL/mol
Refractive index:1.421
Molecular refractive power:33.02 mL/mol
Boiling point:191 °C

Isomers

2-(aminomethyl)butanedioic acid
Molecular structure of 2-(aminomethyl)butanedioic acid
2-aminopentanedioic acid
Molecular structure of 2-aminopentanedioic acid
3-azahexanedioic acid
Molecular structure of 3-azahexanedioic acid
2-(ethoxycarbonylamino)acetic acid
Molecular structure of 2-(ethoxycarbonylamino)acetic acid
ethyl 2-nitropropionate
Molecular structure of ethyl 2-nitropropionate
D-glutamic acid
Molecular structure of D-glutamic acid
glutamic acid
Molecular structure of glutamic acid
N-methylaspartic acid
Molecular structure of N-methylaspartic acid
N-methyliminodiacetic acid
Molecular structure of N-methyliminodiacetic acid
methyl 4-nitrobutanoate
Molecular structure of methyl 4-nitrobutanoate